C29H40N2O7 — CID 177352342
1-[4-(4-methoxyphenyl)-6-nitro-1,3-benzodioxol-5-yl]ethyl N,N-dihexylcarbamate (PubChem CID 177352342) has the molecular formula C29H40N2O7 and a molecular weight of 528.65 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-6-nitro-1,3-benzodioxol-5-yl]ethyl N,N-dihexylcarbamate.
| Compound Name | 1-[4-(4-methoxyphenyl)-6-nitro-1,3-benzodioxol-5-yl]ethyl N,N-dihexylcarbamate |
|---|---|
| PubChem CID | 177352342 |
| Molecular Formula | C29H40N2O7 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-6-nitro-1,3-benzodioxol-5-yl]ethyl N,N-dihexylcarbamate |
| SMILES | CCCCCCN(CCCCCC)C(=O)OC(C)c1c([N+](=O)[O-])cc2c(c1-c1ccc(OC)cc1)OCO2 |
| InChI | InChI=1S/C29H40N2O7/c1-5-7-9-11-17-30(18-12-10-8-6-2)29(32)38-21(3)26-24(31(33)34)19-25-28(37-20-36-25)27(26)22-13-15-23(35-4)16-14-22/h13-16,19,21H,5-12,17-18,20H2,1-4H3 |
| InChIKey | UFQVGAKIKPOAOR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|