C48H83NO6 — CID 177352888
(10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 6-[4-hydroxybutyl-(4-oxo-4-pentadecan-8-yloxybutyl)amino]hexanoate (PubChem CID 177352888) has the molecular formula C48H83NO6 and a molecular weight of 770.19 g/mol. Its IUPAC name is (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 6-[4-hydroxybutyl-(4-oxo-4-pentadecan-8-yloxybutyl)amino]hexanoate.
| Compound Name | (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 6-[4-hydroxybutyl-(4-oxo-4-pentadecan-8-yloxybutyl)amino]hexanoate |
|---|---|
| PubChem CID | 177352888 |
| Molecular Formula | C48H83NO6 |
| Molecular Weight | 770.19 g/mol |
| Exact Mass | 769.62 |
| IUPAC Name | (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 6-[4-hydroxybutyl-(4-oxo-4-pentadecan-8-yloxybutyl)amino]hexanoate |
| SMILES | CCCCCCCC(CCCCCCC)OC(=O)CCCN(CCCCO)CCCCCC(=O)OC1CCC2(C)C(=CCC3C4CCC(=O)C4(C)CCC32)C1 |
| InChI | InChI=1S/C48H83NO6/c1-5-7-9-11-14-21-39(22-15-12-10-8-6-2)54-46(53)24-20-35-49(34-18-19-36-50)33-17-13-16-23-45(52)55-40-29-31-47(3)38(37-40)25-26-41-42-27-28-44(51)48(42,4)32-30-43(41)47/h25,39-43,50H,5-24,26-37H2,1-4H3 |
| InChIKey | NJXATBZLIDUYQZ-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.19 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|