C16H30F3N3O4 — CID 177356846
N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide;(Z)-but-2-ene;ethane (PubChem CID 177356846) has the molecular formula C16H30F3N3O4 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide;(Z)-but-2-ene;ethane.
| Compound Name | N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide;(Z)-but-2-ene;ethane |
|---|---|
| PubChem CID | 177356846 |
| Molecular Formula | C16H30F3N3O4 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[2-(acetamidomethoxy)ethyl]-N-(2-amino-2-oxoethyl)-3,3,3-trifluoropropanamide;(Z)-but-2-ene;ethane |
| SMILES | C/C=C\C.CC.CC(=O)NCOCCN(CC(N)=O)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O4.C4H8.C2H6/c1-7(17)15-6-20-3-2-16(5-8(14)18)9(19)4-10(11,12)13;1-3-4-2;1-2/h2-6H2,1H3,(H2,14,18)(H,15,17);3-4H,1-2H3;1-2H3/b;4-3-; |
| InChIKey | FPRBLESZACKNPL-LWFKIUJUSA-N |
| XLogP | 1.97 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|