C10H17F3N2O2 — CID 60734457
N-prop-2-enyl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide (PubChem CID 60734457) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is N-prop-2-enyl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide.
| Compound Name | N-prop-2-enyl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide |
|---|---|
| PubChem CID | 60734457 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-prop-2-enyl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide |
| SMILES | C=CCNC(=O)C(C)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O2/c1-3-4-15-9(16)8(2)14-5-6-17-7-10(11,12)13/h3,8,14H,1,4-7H2,2H3,(H,15,16) |
| InChIKey | BBUPMKHZGATXSG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|