C28H42FN5O5 — CID 177358064
1-cyclopropyloxy-3-fluorobenzene;ethane;4-[2-(3-hydrazinylpropoxy)ethyl-(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide (PubChem CID 177358064) has the molecular formula C28H42FN5O5 and a molecular weight of 547.67 g/mol. Its IUPAC name is 1-cyclopropyloxy-3-fluorobenzene;ethane;4-[2-(3-hydrazinylpropoxy)ethyl-(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide.
| Compound Name | 1-cyclopropyloxy-3-fluorobenzene;ethane;4-[2-(3-hydrazinylpropoxy)ethyl-(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177358064 |
| Molecular Formula | C28H42FN5O5 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | 1-cyclopropyloxy-3-fluorobenzene;ethane;4-[2-(3-hydrazinylpropoxy)ethyl-(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
| SMILES | CC.CC1CCC(C(=O)N(CCOCCCNN)c2ccnc(C(N)=O)c2)O1.Fc1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C17H27N5O4.C9H9FO.C2H6/c1-12-3-4-15(26-12)17(24)22(8-10-25-9-2-6-21-19)13-5-7-20-14(11-13)16(18)23;10-7-2-1-3-9(6-7)11-8-4-5-8;1-2/h5,7,11-12,15,21H,2-4,6,8-10,19H2,1H3,(H2,18,23);1-3,6,8H,4-5H2;1-2H3 |
| InChIKey | KFFPVTUGUCGCNY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|