About CID 177364720
CID 177364720 (PubChem CID 177364720) has the molecular formula C11H12NO
and a molecular weight of 174.22 g/mol.
Molecular Properties
| Compound Name | CID 177364720 |
| PubChem CID | 177364720 |
| Molecular Formula | C11H12NO |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | — |
| SMILES | [CH2]c1cc(C)ccc1NC(=O)C=C |
| InChI | InChI=1S/C11H12NO/c1-4-11(13)12-10-6-5-8(2)7-9(10)3/h4-7H,1,3H2,2H3,(H,12,13) |
| InChIKey | HZIHFCGXCYVHRA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 177364720 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177364720?
The IUPAC name of CID 177364720 (CID 177364720) is not available.
What is the SMILES notation for CID 177364720?
The canonical SMILES for CID 177364720 is [CH2]c1cc(C)ccc1NC(=O)C=C.
What is the InChIKey of CID 177364720?
The InChIKey is HZIHFCGXCYVHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12NO/c1-4-11(13)12-10-6-5-8(2)7-9(10)3/h4-7H,1,3H2,2H3,(H,12,13).
What are the key properties of CID 177364720?
CID 177364720 has a molecular weight of 174.22 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177364720 is sourced from PubChem (CID 177364720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).