C14H18N4O4 — CID 177365359
3-[5-(3-morpholin-4-ylpropoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 177365359) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-[5-(3-morpholin-4-ylpropoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[5-(3-morpholin-4-ylpropoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 177365359 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-[5-(3-morpholin-4-ylpropoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=c1[nH]c(-c2ccc(OCCCN3CCOCC3)cn2)no1 |
| InChI | InChI=1S/C14H18N4O4/c19-14-16-13(17-22-14)12-3-2-11(10-15-12)21-7-1-4-18-5-8-20-9-6-18/h2-3,10H,1,4-9H2,(H,16,17,19) |
| InChIKey | VPXZPLQBMFFXFW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|