C15H21N5O3 — CID 177365390
3-[5-(4-piperazin-1-ylbutoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 177365390) has the molecular formula C15H21N5O3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-[5-(4-piperazin-1-ylbutoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[5-(4-piperazin-1-ylbutoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 177365390 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-[5-(4-piperazin-1-ylbutoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=c1[nH]c(-c2ccc(OCCCCN3CCNCC3)cn2)no1 |
| InChI | InChI=1S/C15H21N5O3/c21-15-18-14(19-23-15)13-4-3-12(11-17-13)22-10-2-1-7-20-8-5-16-6-9-20/h3-4,11,16H,1-2,5-10H2,(H,18,19,21) |
| InChIKey | QFCSKRZVQLXGFQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|