C15H21ClN4O4 — CID 177365440
3-[5-[3-(4-hydroxypiperidin-1-yl)propoxy]-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one;hydrochloride (PubChem CID 177365440) has the molecular formula C15H21ClN4O4 and a molecular weight of 356.81 g/mol. Its IUPAC name is 3-[5-[3-(4-hydroxypiperidin-1-yl)propoxy]-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one;hydrochloride.
| Compound Name | 3-[5-[3-(4-hydroxypiperidin-1-yl)propoxy]-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one;hydrochloride |
|---|---|
| PubChem CID | 177365440 |
| Molecular Formula | C15H21ClN4O4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-[5-[3-(4-hydroxypiperidin-1-yl)propoxy]-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c(-c2ccc(OCCCN3CCC(O)CC3)cn2)no1 |
| InChI | InChI=1S/C15H20N4O4.ClH/c20-11-4-7-19(8-5-11)6-1-9-22-12-2-3-13(16-10-12)14-17-15(21)23-18-14;/h2-3,10-11,20H,1,4-9H2,(H,17,18,21);1H |
| InChIKey | NFTDZHHERXOMDL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 104.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|