C15H21ClN4O3 — CID 177365517
3-[5-(3-piperidin-1-ylpropoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one;hydrochloride (PubChem CID 177365517) has the molecular formula C15H21ClN4O3 and a molecular weight of 340.81 g/mol. Its IUPAC name is 3-[5-(3-piperidin-1-ylpropoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one;hydrochloride.
| Compound Name | 3-[5-(3-piperidin-1-ylpropoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one;hydrochloride |
|---|---|
| PubChem CID | 177365517 |
| Molecular Formula | C15H21ClN4O3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-[5-(3-piperidin-1-ylpropoxy)-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c(-c2ccc(OCCCN3CCCCC3)cn2)no1 |
| InChI | InChI=1S/C15H20N4O3.ClH/c20-15-17-14(18-22-15)13-6-5-12(11-16-13)21-10-4-9-19-7-2-1-3-8-19;/h5-6,11H,1-4,7-10H2,(H,17,18,20);1H |
| InChIKey | VCZPLJKYBCRCTQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|