C19H20N4O3 — CID 177365363
3-[5-(1-benzylpiperidin-4-yl)oxy-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 177365363) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-[5-(1-benzylpiperidin-4-yl)oxy-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[5-(1-benzylpiperidin-4-yl)oxy-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 177365363 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-[5-(1-benzylpiperidin-4-yl)oxy-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=c1[nH]c(-c2ccc(OC3CCN(Cc4ccccc4)CC3)cn2)no1 |
| InChI | InChI=1S/C19H20N4O3/c24-19-21-18(22-26-19)17-7-6-16(12-20-17)25-15-8-10-23(11-9-15)13-14-4-2-1-3-5-14/h1-7,12,15H,8-11,13H2,(H,21,22,24) |
| InChIKey | XNOHIKDZBJBZES-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |