C9H9ClN3OP — CID 177366312
6-chloro-4-[(phosphanylamino)methyl]-2H-phthalazin-1-one (PubChem CID 177366312) has the molecular formula C9H9ClN3OP and a molecular weight of 241.62 g/mol. Its IUPAC name is 6-chloro-4-[(phosphanylamino)methyl]-2H-phthalazin-1-one.
| Compound Name | 6-chloro-4-[(phosphanylamino)methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 177366312 |
| Molecular Formula | C9H9ClN3OP |
| Molecular Weight | 241.62 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 6-chloro-4-[(phosphanylamino)methyl]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(CNP)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C9H9ClN3OP/c10-5-1-2-6-7(3-5)8(4-11-15)12-13-9(6)14/h1-3,11H,4,15H2,(H,13,14) |
| InChIKey | DNANWPNJSCKWLR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.62 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|