C28H35NO4 — CID 177366328
ethane;ethyl 4-[[2-(3,5-dimethoxyphenyl)-3-phenylpropyl]amino]benzoate (PubChem CID 177366328) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is ethane;ethyl 4-[[2-(3,5-dimethoxyphenyl)-3-phenylpropyl]amino]benzoate.
| Compound Name | ethane;ethyl 4-[[2-(3,5-dimethoxyphenyl)-3-phenylpropyl]amino]benzoate |
|---|---|
| PubChem CID | 177366328 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | ethane;ethyl 4-[[2-(3,5-dimethoxyphenyl)-3-phenylpropyl]amino]benzoate |
| SMILES | CC.CCOC(=O)c1ccc(NCC(Cc2ccccc2)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C26H29NO4.C2H6/c1-4-31-26(28)20-10-12-23(13-11-20)27-18-22(14-19-8-6-5-7-9-19)21-15-24(29-2)17-25(16-21)30-3;1-2/h5-13,15-17,22,27H,4,14,18H2,1-3H3;1-2H3 |
| InChIKey | MZFJBCIJDDNMPF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |