C37H40N2O3 — CID 177366961
2-[4-[3-[4-[(3-aminophenyl)methylcarbamoyl]-2-(3-methylbut-2-en-2-yl)phenyl]-2-methylbutyl]phenyl]benzoic acid (PubChem CID 177366961) has the molecular formula C37H40N2O3 and a molecular weight of 560.74 g/mol. Its IUPAC name is 2-[4-[3-[4-[(3-aminophenyl)methylcarbamoyl]-2-(3-methylbut-2-en-2-yl)phenyl]-2-methylbutyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[3-[4-[(3-aminophenyl)methylcarbamoyl]-2-(3-methylbut-2-en-2-yl)phenyl]-2-methylbutyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 177366961 |
| Molecular Formula | C37H40N2O3 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 2-[4-[3-[4-[(3-aminophenyl)methylcarbamoyl]-2-(3-methylbut-2-en-2-yl)phenyl]-2-methylbutyl]phenyl]benzoic acid |
| SMILES | CC(C)=C(C)c1cc(C(=O)NCc2cccc(N)c2)ccc1C(C)C(C)Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C37H40N2O3/c1-23(2)25(4)35-21-30(36(40)39-22-28-9-8-10-31(38)20-28)17-18-32(35)26(5)24(3)19-27-13-15-29(16-14-27)33-11-6-7-12-34(33)37(41)42/h6-18,20-21,24,26H,19,22,38H2,1-5H3,(H,39,40)(H,41,42) |
| InChIKey | DACVLJOTCYBILI-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|