C25H31BClN3O3 — CID 177367068
2-[6-chloro-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 177367068) has the molecular formula C25H31BClN3O3 and a molecular weight of 467.81 g/mol. Its IUPAC name is 2-[6-chloro-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 2-[6-chloro-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 177367068 |
| Molecular Formula | C25H31BClN3O3 |
| Molecular Weight | 467.81 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-[6-chloro-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CCC(c1nc2ccc(Cl)cc2n1-c1c(C=O)cccc1B1OC(C)(C)C(C)(C)O1)N(C)C |
| InChI | InChI=1S/C25H31BClN3O3/c1-8-20(29(6)7)23-28-19-13-12-17(27)14-21(19)30(23)22-16(15-31)10-9-11-18(22)26-32-24(2,3)25(4,5)33-26/h9-15,20H,8H2,1-7H3 |
| InChIKey | QVSQNEPOQXQDLG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|