C29H28B3F3N3O2P — CID 171643831
CID 171643831 (PubChem CID 171643831) has the molecular formula C29H28B3F3N3O2P and a molecular weight of 570.97 g/mol.
| Compound Name | CID 171643831 |
|---|---|
| PubChem CID | 171643831 |
| Molecular Formula | C29H28B3F3N3O2P |
| Molecular Weight | 570.97 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N(C)C(CC)c1nc2ccc(-c3cc(F)c(P(C)C)cc3C)cc2n1-c1c(C=O)cccc1OC(F)F |
| InChI | InChI=1S/C29H28B3F3N3O2P/c1-6-22(37(3)29(30,31)32)27-36-21-11-10-17(19-14-20(33)25(41(4)5)12-16(19)2)13-23(21)38(27)26-18(15-39)8-7-9-24(26)40-28(34)35/h7-15,22,28H,6H2,1-5H3 |
| InChIKey | ISDQTUDJYAZULE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.97 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|