C26H25F2N5O3 — CID 174338044
3-(difluoromethoxy)-2-[6-[2-[1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]-2-[1-(methylamino)propyl]benzimidazol-1-yl]benzaldehyde (PubChem CID 174338044) has the molecular formula C26H25F2N5O3 and a molecular weight of 493.51 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2-[6-[2-[1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]-2-[1-(methylamino)propyl]benzimidazol-1-yl]benzaldehyde.
| Compound Name | 3-(difluoromethoxy)-2-[6-[2-[1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]-2-[1-(methylamino)propyl]benzimidazol-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 174338044 |
| Molecular Formula | C26H25F2N5O3 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 3-(difluoromethoxy)-2-[6-[2-[1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]-2-[1-(methylamino)propyl]benzimidazol-1-yl]benzaldehyde |
| SMILES | CCC(NC)c1nc2ccc(C#Cc3cnn(CCO)c3)cc2n1-c1c(C=O)cccc1OC(F)F |
| InChI | InChI=1S/C26H25F2N5O3/c1-3-20(29-2)25-31-21-10-9-17(7-8-18-14-30-32(15-18)11-12-34)13-22(21)33(25)24-19(16-35)5-4-6-23(24)36-26(27)28/h4-6,9-10,13-16,20,26,29,34H,3,11-12H2,1-2H3 |
| InChIKey | IZRCLYDNBYIMSL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|