C26H19F2N5O3 — CID 171805966
(1R)-18-(difluoromethoxy)-5-[2-[1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,11(20),14(19),15,17-octaen-13-one (PubChem CID 171805966) has the molecular formula C26H19F2N5O3 and a molecular weight of 487.47 g/mol. Its IUPAC name is (1R)-18-(difluoromethoxy)-5-[2-[1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,11(20),14(19),15,17-octaen-13-one.
| Compound Name | (1R)-18-(difluoromethoxy)-5-[2-[1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,11(20),14(19),15,17-octaen-13-one |
|---|---|
| PubChem CID | 171805966 |
| Molecular Formula | C26H19F2N5O3 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | (1R)-18-(difluoromethoxy)-5-[2-[1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]-12-methyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,11(20),14(19),15,17-octaen-13-one |
| SMILES | CN1C(=O)c2cccc(OC(F)F)c2[C@H]2C=C1c1nc3ccc(C#Cc4cnn(CCO)c4)cc3n12 |
| InChI | InChI=1S/C26H19F2N5O3/c1-31-21-12-20(23-17(25(31)35)3-2-4-22(23)36-26(27)28)33-19-11-15(7-8-18(19)30-24(21)33)5-6-16-13-29-32(14-16)9-10-34/h2-4,7-8,11-14,20,26,34H,9-10H2,1H3/t20-/m1/s1 |
| InChIKey | GKPFWGAAUFLUQT-HXUWFJFHSA-N |
| XLogP | 3.26 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|