C29H34F2N4O4 — CID 171805734
tert-butyl N-[4-[3-[2-(difluoromethoxy)-6-formylphenyl]-2-[1-(dimethylamino)propyl]benzimidazol-5-yl]but-3-ynyl]carbamate (PubChem CID 171805734) has the molecular formula C29H34F2N4O4 and a molecular weight of 540.61 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[2-(difluoromethoxy)-6-formylphenyl]-2-[1-(dimethylamino)propyl]benzimidazol-5-yl]but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[2-(difluoromethoxy)-6-formylphenyl]-2-[1-(dimethylamino)propyl]benzimidazol-5-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 171805734 |
| Molecular Formula | C29H34F2N4O4 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | tert-butyl N-[4-[3-[2-(difluoromethoxy)-6-formylphenyl]-2-[1-(dimethylamino)propyl]benzimidazol-5-yl]but-3-ynyl]carbamate |
| SMILES | CCC(c1nc2ccc(C#CCCNC(=O)OC(C)(C)C)cc2n1-c1c(C=O)cccc1OC(F)F)N(C)C |
| InChI | InChI=1S/C29H34F2N4O4/c1-7-22(34(5)6)26-33-21-15-14-19(11-8-9-16-32-28(37)39-29(2,3)4)17-23(21)35(26)25-20(18-36)12-10-13-24(25)38-27(30)31/h10,12-15,17-18,22,27H,7,9,16H2,1-6H3,(H,32,37) |
| InChIKey | JTOFCYIWFRKBHY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|