C23H19F2N5O2 — CID 174338774
3-(difluoromethoxy)-2-[6-[(Z)-3,6-diiminohex-4-en-1-ynyl]-2-(dimethylamino)benzimidazol-1-yl]benzaldehyde (PubChem CID 174338774) has the molecular formula C23H19F2N5O2 and a molecular weight of 435.43 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2-[6-[(Z)-3,6-diiminohex-4-en-1-ynyl]-2-(dimethylamino)benzimidazol-1-yl]benzaldehyde.
| Compound Name | 3-(difluoromethoxy)-2-[6-[(Z)-3,6-diiminohex-4-en-1-ynyl]-2-(dimethylamino)benzimidazol-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 174338774 |
| Molecular Formula | C23H19F2N5O2 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 3-(difluoromethoxy)-2-[6-[(Z)-3,6-diiminohex-4-en-1-ynyl]-2-(dimethylamino)benzimidazol-1-yl]benzaldehyde |
| SMILES | [H]/N=C/C=C\C(C#Cc1ccc2nc(N(C)C)n(-c3c(C=O)cccc3OC(F)F)c2c1)=N/[H] |
| InChI | InChI=1S/C23H19F2N5O2/c1-29(2)23-28-18-11-9-15(8-10-17(27)6-4-12-26)13-19(18)30(23)21-16(14-31)5-3-7-20(21)32-22(24)25/h3-7,9,11-14,22,26-27H,1-2H3/b6-4-,26-12+,27-17+ |
| InChIKey | ZGZGCJHJVMSLKZ-YQIKLLTASA-N |
| XLogP | 4.08 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|