C27H28ClF2N4O2P — CID 171643407
2-[6-(6-chloro-5-dimethylphosphanyl-2-pyridinyl)-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(difluoromethoxy)benzaldehyde (PubChem CID 171643407) has the molecular formula C27H28ClF2N4O2P and a molecular weight of 544.97 g/mol. Its IUPAC name is 2-[6-(6-chloro-5-dimethylphosphanyl-2-pyridinyl)-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(difluoromethoxy)benzaldehyde.
| Compound Name | 2-[6-(6-chloro-5-dimethylphosphanyl-2-pyridinyl)-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(difluoromethoxy)benzaldehyde |
|---|---|
| PubChem CID | 171643407 |
| Molecular Formula | C27H28ClF2N4O2P |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 2-[6-(6-chloro-5-dimethylphosphanyl-2-pyridinyl)-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(difluoromethoxy)benzaldehyde |
| SMILES | CCC(c1nc2ccc(-c3ccc(P(C)C)c(Cl)n3)cc2n1-c1c(C=O)cccc1OC(F)F)N(C)C |
| InChI | InChI=1S/C27H28ClF2N4O2P/c1-6-20(33(2)3)26-32-19-11-10-16(18-12-13-23(37(4)5)25(28)31-18)14-21(19)34(26)24-17(15-35)8-7-9-22(24)36-27(29)30/h7-15,20,27H,6H2,1-5H3 |
| InChIKey | OAVUXVUMTQAZSR-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|