C24H26F2N4O2 — CID 171805774
2-[6-(4-aminobut-1-ynyl)-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(difluoromethoxy)benzaldehyde (PubChem CID 171805774) has the molecular formula C24H26F2N4O2 and a molecular weight of 440.49 g/mol. Its IUPAC name is 2-[6-(4-aminobut-1-ynyl)-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(difluoromethoxy)benzaldehyde.
| Compound Name | 2-[6-(4-aminobut-1-ynyl)-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(difluoromethoxy)benzaldehyde |
|---|---|
| PubChem CID | 171805774 |
| Molecular Formula | C24H26F2N4O2 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-[6-(4-aminobut-1-ynyl)-2-[1-(dimethylamino)propyl]benzimidazol-1-yl]-3-(difluoromethoxy)benzaldehyde |
| SMILES | CCC(c1nc2ccc(C#CCCN)cc2n1-c1c(C=O)cccc1OC(F)F)N(C)C |
| InChI | InChI=1S/C24H26F2N4O2/c1-4-19(29(2)3)23-28-18-12-11-16(8-5-6-13-27)14-20(18)30(23)22-17(15-31)9-7-10-21(22)32-24(25)26/h7,9-12,14-15,19,24H,4,6,13,27H2,1-3H3 |
| InChIKey | MHPPDXMYLVROAJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|