C25H26F2N4O2 — CID 171806214
3-(difluoromethoxy)-2-[3-(dimethylamino)-7-[4-(methylamino)but-1-ynyl]-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl]benzaldehyde (PubChem CID 171806214) has the molecular formula C25H26F2N4O2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2-[3-(dimethylamino)-7-[4-(methylamino)but-1-ynyl]-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl]benzaldehyde.
| Compound Name | 3-(difluoromethoxy)-2-[3-(dimethylamino)-7-[4-(methylamino)but-1-ynyl]-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 171806214 |
| Molecular Formula | C25H26F2N4O2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-(difluoromethoxy)-2-[3-(dimethylamino)-7-[4-(methylamino)but-1-ynyl]-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl]benzaldehyde |
| SMILES | CNCCC#Cc1ccc2nc3n(c2c1)C(c1c(C=O)cccc1OC(F)F)CC3N(C)C |
| InChI | InChI=1S/C25H26F2N4O2/c1-28-12-5-4-7-16-10-11-18-19(13-16)31-20(14-21(30(2)3)24(31)29-18)23-17(15-32)8-6-9-22(23)33-25(26)27/h6,8-11,13,15,20-21,25,28H,5,12,14H2,1-3H3 |
| InChIKey | UISNGFWBAOLVJF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|