C26H25F2N3O4 — CID 171806271
methyl 6-[3-(difluoromethoxy)-10-ethyl-9-methyl-8-oxo-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-16-yl]hex-5-ynoate (PubChem CID 171806271) has the molecular formula C26H25F2N3O4 and a molecular weight of 481.50 g/mol. Its IUPAC name is methyl 6-[3-(difluoromethoxy)-10-ethyl-9-methyl-8-oxo-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-16-yl]hex-5-ynoate.
| Compound Name | methyl 6-[3-(difluoromethoxy)-10-ethyl-9-methyl-8-oxo-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-16-yl]hex-5-ynoate |
|---|---|
| PubChem CID | 171806271 |
| Molecular Formula | C26H25F2N3O4 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | methyl 6-[3-(difluoromethoxy)-10-ethyl-9-methyl-8-oxo-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-16-yl]hex-5-ynoate |
| SMILES | CCC1c2nc3ccc(C#CCCCC(=O)OC)cc3n2-c2c(OC(F)F)cccc2C(=O)N1C |
| InChI | InChI=1S/C26H25F2N3O4/c1-4-19-24-29-18-14-13-16(9-6-5-7-12-22(32)34-3)15-20(18)31(24)23-17(25(33)30(19)2)10-8-11-21(23)35-26(27)28/h8,10-11,13-15,19,26H,4-5,7,12H2,1-3H3 |
| InChIKey | MHZOOAAADLLAME-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|