C28H28F2N3O6P — CID 171643659
3-(difluoromethoxy)-16-[4-(dimethylphosphorylmethyl)phenyl]-10-ethyl-9-(trihydroxymethyl)-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one (PubChem CID 171643659) has the molecular formula C28H28F2N3O6P and a molecular weight of 571.52 g/mol. Its IUPAC name is 3-(difluoromethoxy)-16-[4-(dimethylphosphorylmethyl)phenyl]-10-ethyl-9-(trihydroxymethyl)-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one.
| Compound Name | 3-(difluoromethoxy)-16-[4-(dimethylphosphorylmethyl)phenyl]-10-ethyl-9-(trihydroxymethyl)-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one |
|---|---|
| PubChem CID | 171643659 |
| Molecular Formula | C28H28F2N3O6P |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 3-(difluoromethoxy)-16-[4-(dimethylphosphorylmethyl)phenyl]-10-ethyl-9-(trihydroxymethyl)-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one |
| SMILES | CCC1c2nc3ccc(-c4ccc(CP(C)(C)=O)cc4)cc3n2-c2c(OC(F)F)cccc2C(=O)N1C(O)(O)O |
| InChI | InChI=1S/C28H28F2N3O6P/c1-4-21-25-31-20-13-12-18(17-10-8-16(9-11-17)15-40(2,3)38)14-22(20)32(25)24-19(26(34)33(21)28(35,36)37)6-5-7-23(24)39-27(29)30/h5-14,21,27,35-37H,4,15H2,1-3H3 |
| InChIKey | MYDDJIFXKUPARG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|