C27H25B2F2N4O4P — CID 171643384
CID 171643384 (PubChem CID 171643384) has the molecular formula C27H25B2F2N4O4P and a molecular weight of 560.12 g/mol.
| Compound Name | CID 171643384 |
|---|---|
| PubChem CID | 171643384 |
| Molecular Formula | C27H25B2F2N4O4P |
| Molecular Weight | 560.12 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)N1C(=O)c2cccc(OC(F)F)c2-n2c(nc3ccc(-c4ccc(OCP(C)C)nc4)cc32)C1CC |
| InChI | InChI=1S/C27H25B2F2N4O4P/c1-4-19-24-33-18-10-8-15(16-9-11-22(32-13-16)38-14-40(2)3)12-20(18)34(24)23-17(25(36)35(19)27(28,29)37)6-5-7-21(23)39-26(30)31/h5-13,19,26,37H,4,14H2,1-3H3 |
| InChIKey | MWDHGYMOVHNRDI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.12 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|