C23H17F2N5O2S — CID 171806220
3-(difluoromethoxy)-10-ethyl-9-methyl-16-[2-(1,2,4-thiadiazol-5-yl)ethynyl]-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one (PubChem CID 171806220) has the molecular formula C23H17F2N5O2S and a molecular weight of 465.49 g/mol. Its IUPAC name is 3-(difluoromethoxy)-10-ethyl-9-methyl-16-[2-(1,2,4-thiadiazol-5-yl)ethynyl]-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one.
| Compound Name | 3-(difluoromethoxy)-10-ethyl-9-methyl-16-[2-(1,2,4-thiadiazol-5-yl)ethynyl]-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one |
|---|---|
| PubChem CID | 171806220 |
| Molecular Formula | C23H17F2N5O2S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 3-(difluoromethoxy)-10-ethyl-9-methyl-16-[2-(1,2,4-thiadiazol-5-yl)ethynyl]-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one |
| SMILES | CCC1c2nc3ccc(C#Cc4ncns4)cc3n2-c2c(OC(F)F)cccc2C(=O)N1C |
| InChI | InChI=1S/C23H17F2N5O2S/c1-3-16-21-28-15-9-7-13(8-10-19-26-12-27-33-19)11-17(15)30(21)20-14(22(31)29(16)2)5-4-6-18(20)32-23(24)25/h4-7,9,11-12,16,23H,3H2,1-2H3 |
| InChIKey | HVVUPBGRIMYVMQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|