C24H19N5O — CID 177154585
10-ethyl-3-ethynyl-9-methyl-16-pyrimidin-5-yl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one (PubChem CID 177154585) has the molecular formula C24H19N5O and a molecular weight of 393.45 g/mol. Its IUPAC name is 10-ethyl-3-ethynyl-9-methyl-16-pyrimidin-5-yl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one.
| Compound Name | 10-ethyl-3-ethynyl-9-methyl-16-pyrimidin-5-yl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one |
|---|---|
| PubChem CID | 177154585 |
| Molecular Formula | C24H19N5O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 10-ethyl-3-ethynyl-9-methyl-16-pyrimidin-5-yl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one |
| SMILES | C#Cc1cccc2c1-n1c(nc3ccc(-c4cncnc4)cc31)C(CC)N(C)C2=O |
| InChI | InChI=1S/C24H19N5O/c1-4-15-7-6-8-18-22(15)29-21-11-16(17-12-25-14-26-13-17)9-10-19(21)27-23(29)20(5-2)28(3)24(18)30/h1,6-14,20H,5H2,2-3H3 |
| InChIKey | LXPZDYRHOSFGAY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|