C32H33N5O — CID 177154649
3-ethynyl-2-[2-[1-(methylamino)propyl]-6-[2-(2-methylspiro[3.3]heptan-2-yl)pyrimidin-5-yl]benzimidazol-1-yl]benzaldehyde (PubChem CID 177154649) has the molecular formula C32H33N5O and a molecular weight of 503.65 g/mol. Its IUPAC name is 3-ethynyl-2-[2-[1-(methylamino)propyl]-6-[2-(2-methylspiro[3.3]heptan-2-yl)pyrimidin-5-yl]benzimidazol-1-yl]benzaldehyde.
| Compound Name | 3-ethynyl-2-[2-[1-(methylamino)propyl]-6-[2-(2-methylspiro[3.3]heptan-2-yl)pyrimidin-5-yl]benzimidazol-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 177154649 |
| Molecular Formula | C32H33N5O |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 3-ethynyl-2-[2-[1-(methylamino)propyl]-6-[2-(2-methylspiro[3.3]heptan-2-yl)pyrimidin-5-yl]benzimidazol-1-yl]benzaldehyde |
| SMILES | C#Cc1cccc(C=O)c1-n1c(C(CC)NC)nc2ccc(-c3cnc(C4(C)CC5(CCC5)C4)nc3)cc21 |
| InChI | InChI=1S/C32H33N5O/c1-5-21-9-7-10-23(18-38)28(21)37-27-15-22(11-12-26(27)36-29(37)25(6-2)33-4)24-16-34-30(35-17-24)31(3)19-32(20-31)13-8-14-32/h1,7,9-12,15-18,25,33H,6,8,13-14,19-20H2,2-4H3 |
| InChIKey | RGUQUIMFBOTFTP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|