C30H30N6O — CID 177154658
16-[2-(1-aminocyclobutyl)pyrimidin-5-yl]-3-but-1-ynyl-10-ethyl-9-methyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one (PubChem CID 177154658) has the molecular formula C30H30N6O and a molecular weight of 490.61 g/mol. Its IUPAC name is 16-[2-(1-aminocyclobutyl)pyrimidin-5-yl]-3-but-1-ynyl-10-ethyl-9-methyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one.
| Compound Name | 16-[2-(1-aminocyclobutyl)pyrimidin-5-yl]-3-but-1-ynyl-10-ethyl-9-methyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one |
|---|---|
| PubChem CID | 177154658 |
| Molecular Formula | C30H30N6O |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 16-[2-(1-aminocyclobutyl)pyrimidin-5-yl]-3-but-1-ynyl-10-ethyl-9-methyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one |
| SMILES | CCC#Cc1cccc2c1-n1c(nc3ccc(-c4cnc(C5(N)CCC5)nc4)cc31)C(CC)N(C)C2=O |
| InChI | InChI=1S/C30H30N6O/c1-4-6-9-19-10-7-11-22-26(19)36-25-16-20(21-17-32-29(33-18-21)30(31)14-8-15-30)12-13-23(25)34-27(36)24(5-2)35(3)28(22)37/h7,10-13,16-18,24H,4-5,8,14-15,31H2,1-3H3 |
| InChIKey | QVTMBQYMAJXXBU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|