C28H26F4N3O6P — CID 171643821
3-(difluoromethoxy)-16-[4-(dimethylphosphorylmethyl)-2,3-difluorophenyl]-10-ethyl-9-(trihydroxymethyl)-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one (PubChem CID 171643821) has the molecular formula C28H26F4N3O6P and a molecular weight of 607.50 g/mol. Its IUPAC name is 3-(difluoromethoxy)-16-[4-(dimethylphosphorylmethyl)-2,3-difluorophenyl]-10-ethyl-9-(trihydroxymethyl)-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one.
| Compound Name | 3-(difluoromethoxy)-16-[4-(dimethylphosphorylmethyl)-2,3-difluorophenyl]-10-ethyl-9-(trihydroxymethyl)-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one |
|---|---|
| PubChem CID | 171643821 |
| Molecular Formula | C28H26F4N3O6P |
| Molecular Weight | 607.50 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 3-(difluoromethoxy)-16-[4-(dimethylphosphorylmethyl)-2,3-difluorophenyl]-10-ethyl-9-(trihydroxymethyl)-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,11,13(18),14,16-heptaen-8-one |
| SMILES | CCC1c2nc3ccc(-c4ccc(CP(C)(C)=O)c(F)c4F)cc3n2-c2c(OC(F)F)cccc2C(=O)N1C(O)(O)O |
| InChI | InChI=1S/C28H26F4N3O6P/c1-4-19-25-33-18-11-9-14(16-10-8-15(13-42(2,3)40)22(29)23(16)30)12-20(18)34(25)24-17(26(36)35(19)28(37,38)39)6-5-7-21(24)41-27(31)32/h5-12,19,27,37-39H,4,13H2,1-3H3 |
| InChIKey | SRRJVFBEQVRNBV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|