C19H13B2ClF3N3O3 — CID 171643658
CID 171643658 (PubChem CID 171643658) has the molecular formula C19H13B2ClF3N3O3 and a molecular weight of 445.40 g/mol.
| Compound Name | CID 171643658 |
|---|---|
| PubChem CID | 171643658 |
| Molecular Formula | C19H13B2ClF3N3O3 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)N1C(=O)c2cccc(OC(F)F)c2-n2c(nc3cc(F)c(Cl)cc32)C1CC |
| InChI | InChI=1S/C19H13B2ClF3N3O3/c1-2-12-16-26-11-7-10(23)9(22)6-13(11)27(16)15-8(17(29)28(12)19(20,21)30)4-3-5-14(15)31-18(24)25/h3-7,12,18,30H,2H2,1H3 |
| InChIKey | KBHGREKPYUFWPX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|