C26H28N6O3 — CID 177372721
(4aS,8aR)-2-methyl-4-[3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 177372721) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is (4aS,8aR)-2-methyl-4-[3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-methyl-4-[3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 177372721 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (4aS,8aR)-2-methyl-4-[3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | CN1N=C(c2cccc(OCCCCOc3ccc(-c4nn[nH]n4)cc3)c2)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C26H28N6O3/c1-32-26(33)23-10-3-2-9-22(23)24(29-32)19-7-6-8-21(17-19)35-16-5-4-15-34-20-13-11-18(12-14-20)25-27-30-31-28-25/h2-3,6-8,11-14,17,22-23H,4-5,9-10,15-16H2,1H3,(H,27,28,30,31)/t22-,23+/m0/s1 |
| InChIKey | ATGOHUNNEVBYOA-XZOQPEGZSA-N |
| XLogP | 3.86 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|