C24H30N6O2 — CID 177374171
1-(cyclohexylmethyl)-8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione (PubChem CID 177374171) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-(cyclohexylmethyl)-8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 177374171 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-(cyclohexylmethyl)-8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(NCCc2c[nH]c3ccccc23)nc2c1c(=O)n(CC1CCCCC1)c(=O)n2C |
| InChI | InChI=1S/C24H30N6O2/c1-28-20-21(29(2)24(32)30(22(20)31)15-16-8-4-3-5-9-16)27-23(28)25-13-12-17-14-26-19-11-7-6-10-18(17)19/h6-7,10-11,14,16,26H,3-5,8-9,12-13,15H2,1-2H3,(H,25,27) |
| InChIKey | OSCYSDMGDDHDPD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |