C20H18N8O — CID 177375856
(7R)-2-[(3-amino-1H-indazol-6-yl)amino]-7-methyl-5,8-bis(prop-2-ynyl)-7H-pteridin-6-one (PubChem CID 177375856) has the molecular formula C20H18N8O and a molecular weight of 386.42 g/mol. Its IUPAC name is (7R)-2-[(3-amino-1H-indazol-6-yl)amino]-7-methyl-5,8-bis(prop-2-ynyl)-7H-pteridin-6-one.
| Compound Name | (7R)-2-[(3-amino-1H-indazol-6-yl)amino]-7-methyl-5,8-bis(prop-2-ynyl)-7H-pteridin-6-one |
|---|---|
| PubChem CID | 177375856 |
| Molecular Formula | C20H18N8O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (7R)-2-[(3-amino-1H-indazol-6-yl)amino]-7-methyl-5,8-bis(prop-2-ynyl)-7H-pteridin-6-one |
| SMILES | C#CCN1C(=O)[C@@H](C)N(CC#C)c2nc(Nc3ccc4c(N)n[nH]c4c3)ncc21 |
| InChI | InChI=1S/C20H18N8O/c1-4-8-27-12(3)19(29)28(9-5-2)16-11-22-20(24-18(16)27)23-13-6-7-14-15(10-13)25-26-17(14)21/h1-2,6-7,10-12H,8-9H2,3H3,(H3,21,25,26)(H,22,23,24)/t12-/m1/s1 |
| InChIKey | XCWZMDVHDKCZRP-GFCCVEGCSA-N |
| XLogP | 1.49 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|