C19H18BN5O3 — CID 177375859
[4-[[(7R)-7-methyl-6-oxo-5,8-bis(prop-2-ynyl)-7H-pteridin-2-yl]amino]phenyl]boronic acid (PubChem CID 177375859) has the molecular formula C19H18BN5O3 and a molecular weight of 375.20 g/mol. Its IUPAC name is [4-[[(7R)-7-methyl-6-oxo-5,8-bis(prop-2-ynyl)-7H-pteridin-2-yl]amino]phenyl]boronic acid.
| Compound Name | [4-[[(7R)-7-methyl-6-oxo-5,8-bis(prop-2-ynyl)-7H-pteridin-2-yl]amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 177375859 |
| Molecular Formula | C19H18BN5O3 |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [4-[[(7R)-7-methyl-6-oxo-5,8-bis(prop-2-ynyl)-7H-pteridin-2-yl]amino]phenyl]boronic acid |
| SMILES | C#CCN1C(=O)[C@@H](C)N(CC#C)c2nc(Nc3ccc(B(O)O)cc3)ncc21 |
| InChI | InChI=1S/C19H18BN5O3/c1-4-10-24-13(3)18(26)25(11-5-2)16-12-21-19(23-17(16)24)22-15-8-6-14(7-9-15)20(27)28/h1-2,6-9,12-13,27-28H,10-11H2,3H3,(H,21,22,23)/t13-/m1/s1 |
| InChIKey | YVZIIENKJMMGCO-CYBMUJFWSA-N |
| XLogP | -0.29 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|