C21H27ClN4O3S — CID 177378176
N-[4-[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]cyclohexyl]acetamide (PubChem CID 177378176) has the molecular formula C21H27ClN4O3S and a molecular weight of 450.99 g/mol. Its IUPAC name is N-[4-[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]cyclohexyl]acetamide.
| Compound Name | N-[4-[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 177378176 |
| Molecular Formula | C21H27ClN4O3S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[4-[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(c2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)CC1 |
| InChI | InChI=1S/C21H27ClN4O3S/c1-13(2)30(28,29)19-7-5-4-6-18(19)25-21-17(22)12-23-20(26-21)15-8-10-16(11-9-15)24-14(3)27/h4-7,12-13,15-16H,8-11H2,1-3H3,(H,24,27)(H,23,25,26) |
| InChIKey | USDBEZRARXRGGK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |