C33H37N5O3 — CID 177378618
3-[1-[3-(5-methylimidazol-1-yl)propyl]indol-3-yl]-4-[4-(3-piperidin-1-ylpropoxy)phenyl]pyrrole-2,5-dione (PubChem CID 177378618) has the molecular formula C33H37N5O3 and a molecular weight of 551.69 g/mol. Its IUPAC name is 3-[1-[3-(5-methylimidazol-1-yl)propyl]indol-3-yl]-4-[4-(3-piperidin-1-ylpropoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(5-methylimidazol-1-yl)propyl]indol-3-yl]-4-[4-(3-piperidin-1-ylpropoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 177378618 |
| Molecular Formula | C33H37N5O3 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 3-[1-[3-(5-methylimidazol-1-yl)propyl]indol-3-yl]-4-[4-(3-piperidin-1-ylpropoxy)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1cncn1CCCn1cc(C2=C(c3ccc(OCCCN4CCCCC4)cc3)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C33H37N5O3/c1-24-21-34-23-38(24)19-7-18-37-22-28(27-9-3-4-10-29(27)37)31-30(32(39)35-33(31)40)25-11-13-26(14-12-25)41-20-8-17-36-15-5-2-6-16-36/h3-4,9-14,21-23H,2,5-8,15-20H2,1H3,(H,35,39,40) |
| InChIKey | WKHOSOXYYILGOG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|