C34H39N5O3 — CID 177378621
3-[1-[3-(5-methylimidazol-1-yl)propyl]indol-3-yl]-4-[4-(4-piperidin-1-ylbutoxy)phenyl]pyrrole-2,5-dione (PubChem CID 177378621) has the molecular formula C34H39N5O3 and a molecular weight of 565.72 g/mol. Its IUPAC name is 3-[1-[3-(5-methylimidazol-1-yl)propyl]indol-3-yl]-4-[4-(4-piperidin-1-ylbutoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(5-methylimidazol-1-yl)propyl]indol-3-yl]-4-[4-(4-piperidin-1-ylbutoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 177378621 |
| Molecular Formula | C34H39N5O3 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | 3-[1-[3-(5-methylimidazol-1-yl)propyl]indol-3-yl]-4-[4-(4-piperidin-1-ylbutoxy)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1cncn1CCCn1cc(C2=C(c3ccc(OCCCCN4CCCCC4)cc3)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C34H39N5O3/c1-25-22-35-24-39(25)20-9-19-38-23-29(28-10-3-4-11-30(28)38)32-31(33(40)36-34(32)41)26-12-14-27(15-13-26)42-21-8-7-18-37-16-5-2-6-17-37/h3-4,10-15,22-24H,2,5-9,16-21H2,1H3,(H,36,40,41) |
| InChIKey | LVDBFFMFRUXAKZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|