C18H22F3N — CID 177381475
(1R,4R,5R)-2,2,6-trimethyl-4-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.3.1]non-6-ene (PubChem CID 177381475) has the molecular formula C18H22F3N and a molecular weight of 309.38 g/mol. Its IUPAC name is (1R,4R,5R)-2,2,6-trimethyl-4-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.3.1]non-6-ene.
| Compound Name | (1R,4R,5R)-2,2,6-trimethyl-4-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 177381475 |
| Molecular Formula | C18H22F3N |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (1R,4R,5R)-2,2,6-trimethyl-4-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.3.1]non-6-ene |
| SMILES | CC1=CC[C@@H]2C[C@H]1[C@H](c1ccc(C(F)(F)F)cc1)NC2(C)C |
| InChI | InChI=1S/C18H22F3N/c1-11-4-7-14-10-15(11)16(22-17(14,2)3)12-5-8-13(9-6-12)18(19,20)21/h4-6,8-9,14-16,22H,7,10H2,1-3H3/t14-,15-,16+/m1/s1 |
| InChIKey | PZHHLSGOOPMLSH-OAGGEKHMSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|