C19H19NO — CID 177385441
(3R)-5-(4-methylphenyl)-1-oxido-3-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyrrol-1-ium (PubChem CID 177385441) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is (3R)-5-(4-methylphenyl)-1-oxido-3-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyrrol-1-ium.
| Compound Name | (3R)-5-(4-methylphenyl)-1-oxido-3-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 177385441 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (3R)-5-(4-methylphenyl)-1-oxido-3-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyrrol-1-ium |
| SMILES | Cc1ccc(C2=[N+]([O-])C[C@@H](/C=C/c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H19NO/c1-15-7-11-18(12-8-15)19-13-17(14-20(19)21)10-9-16-5-3-2-4-6-16/h2-12,17H,13-14H2,1H3/b10-9+/t17-/m0/s1 |
| InChIKey | WHKIQSGAUKDQCL-FVNWOWOISA-N |
| XLogP | 4.03 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|