C25H23N3O2 — CID 177390028
1-benzyl-3-[5-methyl-2-[(4-methylphenyl)diazenyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 177390028) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-benzyl-3-[5-methyl-2-[(4-methylphenyl)diazenyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-benzyl-3-[5-methyl-2-[(4-methylphenyl)diazenyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 177390028 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-benzyl-3-[5-methyl-2-[(4-methylphenyl)diazenyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(/N=N/c2ccc(C)cc2C2CC(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O2/c1-17-8-11-20(12-9-17)26-27-23-13-10-18(2)14-21(23)22-15-24(29)28(25(22)30)16-19-6-4-3-5-7-19/h3-14,22H,15-16H2,1-2H3/b27-26+ |
| InChIKey | MDRKTPQNADVASI-CYYJNZCTSA-N |
| XLogP | 5.76 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|