C24H29BO3 — CID 177392996
(1E,4E)-2-methyl-1,5-diphenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,4-dien-3-ol (PubChem CID 177392996) has the molecular formula C24H29BO3 and a molecular weight of 376.31 g/mol. Its IUPAC name is (1E,4E)-2-methyl-1,5-diphenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,4-dien-3-ol.
| Compound Name | (1E,4E)-2-methyl-1,5-diphenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 177392996 |
| Molecular Formula | C24H29BO3 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (1E,4E)-2-methyl-1,5-diphenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,4-dien-3-ol |
| SMILES | C/C(=C\c1ccccc1)C(O)/C(=C/c1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H29BO3/c1-18(16-19-12-8-6-9-13-19)22(26)21(17-20-14-10-7-11-15-20)25-27-23(2,3)24(4,5)28-25/h6-17,22,26H,1-5H3/b18-16+,21-17- |
| InChIKey | GZCUINANSCRCGX-MELVWCACSA-N |
| XLogP | 5.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|