C24H29BO4 — CID 102221538
(E)-1-(2-methyl-3-phenyloxiran-2-yl)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 102221538) has the molecular formula C24H29BO4 and a molecular weight of 392.30 g/mol. Its IUPAC name is (E)-1-(2-methyl-3-phenyloxiran-2-yl)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | (E)-1-(2-methyl-3-phenyloxiran-2-yl)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 102221538 |
| Molecular Formula | C24H29BO4 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (E)-1-(2-methyl-3-phenyloxiran-2-yl)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C(O)/C(=C/c2ccccc2)B2OC(C)(C)C(C)(C)O2)OC1c1ccccc1 |
| InChI | InChI=1S/C24H29BO4/c1-22(2)23(3,4)29-25(28-22)19(16-17-12-8-6-9-13-17)20(26)24(5)21(27-24)18-14-10-7-11-15-18/h6-16,20-21,26H,1-5H3/b19-16- |
| InChIKey | ZVQGLMWALZRCBS-MNDPQUGUSA-N |
| XLogP | 4.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|