C27H32BFO2 — CID 166448787
2-[(2Z,5Z,7E)-5-fluoro-7-methyl-3,8-diphenylocta-2,5,7-trien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 166448787) has the molecular formula C27H32BFO2 and a molecular weight of 418.36 g/mol. Its IUPAC name is 2-[(2Z,5Z,7E)-5-fluoro-7-methyl-3,8-diphenylocta-2,5,7-trien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2Z,5Z,7E)-5-fluoro-7-methyl-3,8-diphenylocta-2,5,7-trien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 166448787 |
| Molecular Formula | C27H32BFO2 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-[(2Z,5Z,7E)-5-fluoro-7-methyl-3,8-diphenylocta-2,5,7-trien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C/C(B1OC(C)(C)C(C)(C)O1)=C(/C/C(F)=C/C(C)=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32BFO2/c1-20(17-22-13-9-7-10-14-22)18-24(29)19-25(23-15-11-8-12-16-23)21(2)28-30-26(3,4)27(5,6)31-28/h7-18H,19H2,1-6H3/b20-17+,24-18-,25-21+ |
| InChIKey | ZEGLXGIXGQNVOD-OWKQSANHSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|