C27H45N3O9 — CID 177395306
(2S)-2-[[3,4-bis[2-(2-hydroxyethoxy)ethoxy]benzoyl]amino]-N,N'-dibutylbutanediamide (PubChem CID 177395306) has the molecular formula C27H45N3O9 and a molecular weight of 555.67 g/mol. Its IUPAC name is (2S)-2-[[3,4-bis[2-(2-hydroxyethoxy)ethoxy]benzoyl]amino]-N,N'-dibutylbutanediamide.
| Compound Name | (2S)-2-[[3,4-bis[2-(2-hydroxyethoxy)ethoxy]benzoyl]amino]-N,N'-dibutylbutanediamide |
|---|---|
| PubChem CID | 177395306 |
| Molecular Formula | C27H45N3O9 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | (2S)-2-[[3,4-bis[2-(2-hydroxyethoxy)ethoxy]benzoyl]amino]-N,N'-dibutylbutanediamide |
| SMILES | CCCCNC(=O)C[C@H](NC(=O)c1ccc(OCCOCCO)c(OCCOCCO)c1)C(=O)NCCCC |
| InChI | InChI=1S/C27H45N3O9/c1-3-5-9-28-25(33)20-22(27(35)29-10-6-4-2)30-26(34)21-7-8-23(38-17-15-36-13-11-31)24(19-21)39-18-16-37-14-12-32/h7-8,19,22,31-32H,3-6,9-18,20H2,1-2H3,(H,28,33)(H,29,35)(H,30,34)/t22-/m0/s1 |
| InChIKey | PTDTUFUNSFWIOJ-QFIPXVFZSA-N |
| XLogP | 0.78 |
| TPSA | 164.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|