C28H47N3O6 — CID 177429891
N,N'-dihexyl-2-[[2-[2-(2-hydroxyethoxy)ethoxy]benzoyl]amino]pentanediamide (PubChem CID 177429891) has the molecular formula C28H47N3O6 and a molecular weight of 521.70 g/mol. Its IUPAC name is N,N'-dihexyl-2-[[2-[2-(2-hydroxyethoxy)ethoxy]benzoyl]amino]pentanediamide.
| Compound Name | N,N'-dihexyl-2-[[2-[2-(2-hydroxyethoxy)ethoxy]benzoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 177429891 |
| Molecular Formula | C28H47N3O6 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | N,N'-dihexyl-2-[[2-[2-(2-hydroxyethoxy)ethoxy]benzoyl]amino]pentanediamide |
| SMILES | CCCCCCNC(=O)CCC(NC(=O)c1ccccc1OCCOCCO)C(=O)NCCCCCC |
| InChI | InChI=1S/C28H47N3O6/c1-3-5-7-11-17-29-26(33)16-15-24(28(35)30-18-12-8-6-4-2)31-27(34)23-13-9-10-14-25(23)37-22-21-36-20-19-32/h9-10,13-14,24,32H,3-8,11-12,15-22H2,1-2H3,(H,29,33)(H,30,35)(H,31,34) |
| InChIKey | LHAWSZHCVHMGTP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|