C22H15ClO7 — CID 177395800
(1S)-14-chloro-6-hydroxy-15-(methoxymethoxy)-2,20-dioxahexacyclo[9.8.1.11,12.13,7.011,22.016,21]docosa-3(22),4,6,12,14,16(21),18-heptaene-8,17-dione (PubChem CID 177395800) has the molecular formula C22H15ClO7 and a molecular weight of 426.81 g/mol. Its IUPAC name is (1S)-14-chloro-6-hydroxy-15-(methoxymethoxy)-2,20-dioxahexacyclo[9.8.1.11,12.13,7.011,22.016,21]docosa-3(22),4,6,12,14,16(21),18-heptaene-8,17-dione.
| Compound Name | (1S)-14-chloro-6-hydroxy-15-(methoxymethoxy)-2,20-dioxahexacyclo[9.8.1.11,12.13,7.011,22.016,21]docosa-3(22),4,6,12,14,16(21),18-heptaene-8,17-dione |
|---|---|
| PubChem CID | 177395800 |
| Molecular Formula | C22H15ClO7 |
| Molecular Weight | 426.81 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (1S)-14-chloro-6-hydroxy-15-(methoxymethoxy)-2,20-dioxahexacyclo[9.8.1.11,12.13,7.011,22.016,21]docosa-3(22),4,6,12,14,16(21),18-heptaene-8,17-dione |
| SMILES | COCOc1c(Cl)cc2c3c1C(=O)C=C[C@@]31Oc3ccc(O)c4c3C2(CCC4=O)O1 |
| InChI | InChI=1S/C22H15ClO7/c1-27-9-28-20-11(23)8-10-18-17(20)14(26)5-7-22(18)29-15-3-2-12(24)16-13(25)4-6-21(10,30-22)19(15)16/h2-3,5,7-8,24H,4,6,9H2,1H3/t21?,22-/m0/s1 |
| InChIKey | PWJYFNDKBSQGSV-KEKNWZKVSA-N |
| XLogP | 3.58 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.81 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|