C18H24N2O6 — CID 177397323
methyl 3-[(Z)-N-hydroxy-C-(4-methoxy-3-nitrophenyl)carbonimidoyl]-1,2,2-trimethylcyclopentane-1-carboxylate (PubChem CID 177397323) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 3-[(Z)-N-hydroxy-C-(4-methoxy-3-nitrophenyl)carbonimidoyl]-1,2,2-trimethylcyclopentane-1-carboxylate.
| Compound Name | methyl 3-[(Z)-N-hydroxy-C-(4-methoxy-3-nitrophenyl)carbonimidoyl]-1,2,2-trimethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 177397323 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl 3-[(Z)-N-hydroxy-C-(4-methoxy-3-nitrophenyl)carbonimidoyl]-1,2,2-trimethylcyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(C)CCC(/C(=N/O)c2ccc(OC)c([N+](=O)[O-])c2)C1(C)C |
| InChI | InChI=1S/C18H24N2O6/c1-17(2)12(8-9-18(17,3)16(21)26-5)15(19-22)11-6-7-14(25-4)13(10-11)20(23)24/h6-7,10,12,22H,8-9H2,1-5H3/b19-15+ |
| InChIKey | BMEXKFVASGABGM-XDJHFCHBSA-N |
| XLogP | 3.40 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|