C41H44N2O8Se — CID 177399402
1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-propan-2-ylselanyloxolan-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 177399402) has the molecular formula C41H44N2O8Se and a molecular weight of 771.77 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-propan-2-ylselanyloxolan-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-propan-2-ylselanyloxolan-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177399402 |
| Molecular Formula | C41H44N2O8Se |
| Molecular Weight | 771.77 g/mol |
| Exact Mass | 772.23 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-propan-2-ylselanyloxolan-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)n(COCc4ccccc4)c3=O)[C@H]([Se]C(C)C)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H44N2O8Se/c1-28(2)52-38-37(45)35(51-39(38)42-24-23-36(44)43(40(42)46)27-49-25-29-11-7-5-8-12-29)26-50-41(30-13-9-6-10-14-30,31-15-19-33(47-3)20-16-31)32-17-21-34(48-4)22-18-32/h5-24,28,35,37-39,45H,25-27H2,1-4H3/t35-,37-,38-,39-/m1/s1 |
| InChIKey | OUKOFJMCZCTXBM-JMGLZSBTSA-N |
| XLogP | 5.79 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.77 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|